| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,4-Difluoro-2-methylbenzoic acid Basic information |
| Product Name: | 3,4-Difluoro-2-methylbenzoic acid | | Synonyms: | 3,4-Difloro-2-methylbenzoic acid;3,4-Difluoro-2-Methylbenzoic acid, 97+%;6-Carboxy-2,3-difluorotoluene, 3,4-Difluoro-o-toluic acid;Benzoic acid, 3,4-difluoro-2-methyl-;3,4-Difluoro-2-methylbenzoic acid | | CAS: | 157652-31-8 | | MF: | C8H6F2O2 | | MW: | 172.13 | | EINECS: | | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Fluorin-contained Benzoic acid series | | Mol File: | 157652-31-8.mol |  |
| | 3,4-Difluoro-2-methylbenzoic acid Chemical Properties |
| Melting point | 152-156℃ | | Boiling point | 268.0±35.0 °C(Predicted) | | density | 1.359±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder | | pka | 3.52±0.25(Predicted) | | color | White | | Water Solubility | Insoluble in water. | | InChI | InChI=1S/C8H6F2O2/c1-4-5(8(11)12)2-3-6(9)7(4)10/h2-3H,1H3,(H,11,12) | | InChIKey | AGUUCAUQWFAFPR-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(F)C(F)=C1C |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HS Code | 2916399090 |
| | 3,4-Difluoro-2-methylbenzoic acid Usage And Synthesis |
| Uses | 3,4-Difluoro-2-methylbenzoic acid, is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. It is also used in medicine field, electronic industry and polymer material. |
| | 3,4-Difluoro-2-methylbenzoic acid Preparation Products And Raw materials |
|