| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
(S)-2-Aminohex-5-ynoic acid manufacturers
|
| | (S)-2-Aminohex-5-ynoic acid Basic information |
| Product Name: | (S)-2-Aminohex-5-ynoic acid | | Synonyms: | H-HoMoGly(Propargyl)-OH;(S)-2-Amino-5-hexynoic acid;L-Homopropargylglycine (HPG);L-Homopropargylglycine (L-HPG);H-Abu(ethynyl)-OH;(2S)-2-aminohex-5-ynoic acid;5-Hexynoic acid, 2-amino-, (2S)-;(S)-2-Aminohex-5-ynoicaci | | CAS: | 98891-36-2 | | MF: | C6H9NO2 | | MW: | 127.14 | | EINECS: | | | Product Categories: | Unusual Amino Acids | | Mol File: | 98891-36-2.mol |  |
| | (S)-2-Aminohex-5-ynoic acid Chemical Properties |
| Melting point | 162°C | | Boiling point | 260.5±35.0 °C(Predicted) | | density | 1.155±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Aqueous Acid (Sparingly), Methanol (Slightly), Water (Slightly) | | form | powder or crystals | | pka | 2.21±0.10(Predicted) | | color | White to Off-White | | Appearance | off-white solid | | Stability: | Hygroscopic | | InChI | 1S/C6H9NO2/c1-2-3-4-5(7)6(8)9/h1,5H,3-4,7H2,(H,8,9) | | InChIKey | SCGJGNWMYSYORS-UHFFFAOYSA-N | | SMILES | O=C(O[H])[C@@](C([H])([H])C([H])([H])C#C[H])([H])N([H])[H].Cl[H] | | CAS DataBase Reference | 98891-36-2 |
| WGK Germany | WGK 3 | | HS Code | 2924297099 | | Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials | | Hazard Classifications | Self-react. C |
| | (S)-2-Aminohex-5-ynoic acid Usage And Synthesis |
| Description | L-Homopropargylglycine (HPG) is a noncanonical amino acid analog of methionine that contains a terminal alkyne moiety. HPG-labeling is a fast, sensitive, non-toxic, and non-radioactive alternative to the traditional technique for detecting nascent protein synthesis.
HPG is the cell-permeable compound randomly incorporated into synthesizing protein instead of methionine during translation. The resulting alkyne-labeled full-length proteins can be detected via copper-catalyzed click reaction with fluorescent or biotin-labeled azides and used for subsequent microscopic imaging or purification tasks. | | Uses | L-Homopropargyl glycine is a reactive methionine analog that contains an alkyne moiety. It is readily inserted into newly-synthesized proteins in place of methionine. L-Homopropargyl glycine can then be labeled or captured through click chemistry. This approach represents a fast, sensitive, and non-radioactive alternative to [35S]-methionine for the detection of nascent protein synthesis. | | Uses | L-Homopropargylglycine (HPG) is an amino acid analog of methionine that contains a very small modification, specifically an alkyne moiety. This compound can be fed to cultured cells and incorporated into proteins during active protein synthesis. Detection utilizes the chemoselective ligation or “click” reaction between an azide and an alkyne or cyclooctyne. For example the alkyne-modified protein can be detected with either fluorescent azide or biotin azide. Detection sensitivity with these reagents in 1-D gels and Western blots is in the low femtomole range and compatible with downstream LC-MS/MS and MALDI-MS analysis. | | IC 50 | Alkyl-Chain |
| | (S)-2-Aminohex-5-ynoic acid Preparation Products And Raw materials |
|