| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Boc-(S)-3-amino-5-hexenoic acid manufacturers
|
| | Boc-(S)-3-amino-5-hexenoic acid Basic information |
| | Boc-(S)-3-amino-5-hexenoic acid Chemical Properties |
| Boiling point | 372.2±35.0 °C(Predicted) | | density | 1.078 | | storage temp. | 2-8°C | | pka | 4.43±0.10(Predicted) | | form | lumps | | Appearance | White to off-white Solid | | Optical Rotation | [α]/D +20±1°, c = 1 in ethanol | | BRN | 9127734 | | Major Application | peptide synthesis | | InChI | 1S/C11H19NO4/c1-5-6-8(7-9(13)14)12-10(15)16-11(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,12,15)(H,13,14)/t8-/m0/s1 | | InChIKey | RFHPQLCVYMBPRF-QMMMGPOBSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CC=C)CC(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29241990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Boc-(S)-3-amino-5-hexenoic acid Usage And Synthesis |
| Uses | (S)-3-(Boc-amino)-5-hexenoic acid can be used as a reactant for the preparation of lactam bridged peptide mimics by peptide coupling and olefin metathesis. |
| | Boc-(S)-3-amino-5-hexenoic acid Preparation Products And Raw materials |
|