|
|
| | Boc-(R)-3-amino-5-hexenoic acid Basic information |
| | Boc-(R)-3-amino-5-hexenoic acid Chemical Properties |
| storage temp. | 2-8°C | | form | lumps | | Optical Rotation | [α]/D -20.0±1°, c = 1 in ethanol | | BRN | 9397198 | | Major Application | peptide synthesis | | InChI | 1S/C11H19NO4/c1-5-6-8(7-9(13)14)12-10(15)16-11(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,12,15)(H,13,14)/t8-/m1/s1 | | InChIKey | RFHPQLCVYMBPRF-MRVPVSSYSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CC=C)CC(O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Boc-(R)-3-amino-5-hexenoic acid Usage And Synthesis |
| | Boc-(R)-3-amino-5-hexenoic acid Preparation Products And Raw materials |
|