CYCLO(-ALA-GLY) manufacturers
- CYCLO(-ALA-GLY)
-
- $25.00
-
2025-12-12
- CAS:4526-77-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200000KG
|
| | CYCLO(-ALA-GLY) Basic information |
| Product Name: | CYCLO(-ALA-GLY) | | Synonyms: | CYCLO(-ALA-GLY);cyclo(alanyl-glycyl);(3S)-3-Methylpiperazine-2,5-dione;Cyclo(Gly-Ala-);3-methylpiperazine-2,5-quinone;(S)-3-Methyl-2,5-piperazinedione;Cyclo(glycyl-L-alanyl);2,5-Piperazinedione,3-methyl-, (3S)- | | CAS: | 4526-77-6 | | MF: | C5H8N2O2 | | MW: | 128.13 | | EINECS: | | | Product Categories: | | | Mol File: | 4526-77-6.mol |  |
| | CYCLO(-ALA-GLY) Chemical Properties |
| Melting point | 246-247℃ | | density | 1.149 | | storage temp. | -15°C | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) | | form | Solid | | color | White to Off-White | | Sequence | Cyclo(Ala-Gly) | | InChI | InChI=1S/C5H8N2O2/c1-3-5(9)6-2-4(8)7-3/h3H,2H2,1H3,(H,6,9)(H,7,8)/t3-/m0/s1 | | InChIKey | ICCHEGCKVBMSTF-VKHMYHEASA-N | | SMILES | N1CC(=O)N[C@@H](C)C1=O | | CAS DataBase Reference | 4526-77-6 |
| | CYCLO(-ALA-GLY) Usage And Synthesis |
| Chemical Properties | White crystalline | | Uses | Cyclo(L-Ala-L-Gly) is able to cause gelation in a wide variety of organic fluids, including edible oils, glyceryl esters, alcohols, and aromatic molecules. |
| | CYCLO(-ALA-GLY) Preparation Products And Raw materials |
|