|
|
| | 1-Bromo-4-chloro-2-fluorobenzene Basic information |
| | 1-Bromo-4-chloro-2-fluorobenzene Chemical Properties |
| Boiling point | 91-92 °C/20 mmHg (lit.) | | density | 1.678 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.556(lit.) | | Fp | 198 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | Specific Gravity | 1.678 | | color | Clear colorless to pale yellow | | Water Solubility | INSOLUBLE | | BRN | 2081083 | | InChI | InChI=1S/C6H3BrClF/c7-5-2-1-4(8)3-6(5)9/h1-3H | | InChIKey | FPNVMCMDWZNTEU-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(Cl)C=C1F | | CAS DataBase Reference | 1996-29-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 10 - Combustible liquids |
| | 1-Bromo-4-chloro-2-fluorobenzene Usage And Synthesis |
| Chemical Properties | CLEAR COLORLESS TO PALE YELLOW LIQUID | | Uses | A 2,4-dihalofluorobenzene derivative with antibacterial and antifungal activities. | | Uses | 1-Bromo-4-chloro-2-fluorobenzene may be used in the preparation of benzonorbornadiene derivative. It may also be used as a starting material in the multi-step synthesis of AZD3264, an IKK2 (inhibitor of nuclear factor κ-B kinase-2) inhibitor. | | General Description | 1-Bromo-4-chloro-2-fluorobenzene is a polyhalo substituted benzene. It undergoes Suzuki coupling with 2-cyanoarylboronic esters to form the corresponding biphenyls. These biphenyls are the precursors for synthesizing 6-substituted phenanthridines. The enthalpy of vaporization at boiling point (467.15K) of 1-bromo-4-chloro-2-fluorobenzene is 40.737kjoule/mol. | | Pharmaceutical Applications | 1-Bromo-4-chloro-2-fluorobenzene serves as a crucial building block for synthesizing brilanestrant, a selective estrogen receptor degrader used in the treatment of breast cancer. It controls the potency on the degradation of estrogen receptor 1 (ERα), demonstrating an effective concentration of 0.7 nM. |
| | 1-Bromo-4-chloro-2-fluorobenzene Preparation Products And Raw materials |
|