|
|
| | 4-Bromo-1-chloro-2-fluorobenzene Basic information |
| | 4-Bromo-1-chloro-2-fluorobenzene Chemical Properties |
| Boiling point | 62-64°C 9mm | | density | 1,71 g/cm3 | | refractive index | 1.5544-1.5564 | | Fp | 62-64°C/9mm | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | Water Solubility | INSOLUBLE | | BRN | 2206649 | | InChI | InChI=1S/C6H3BrClF/c7-4-1-2-5(8)6(9)3-4/h1-3H | | InChIKey | AGYWDGVTLKNTBS-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(Br)C=C1F | | CAS DataBase Reference | 60811-18-9(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-36-22 | | Safety Statements | 37/39-26-37 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Irrit. 2 |
| | 4-Bromo-1-chloro-2-fluorobenzene Usage And Synthesis |
| Chemical Properties | colorless to yellowish liquid | | Uses | 4-Bromo-1-chloro-2-fluorobenzene is a vital organic compound that could be used to synthesise 4-Chloro-3-fluorobenzoic acid, etc. |
| | 4-Bromo-1-chloro-2-fluorobenzene Preparation Products And Raw materials |
|