| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- Fmoc-2-Pal-OH
-
- $41.00
-
2026-05-11
- CAS:185379-40-2
- Purity:
- Supply Ability: 10g
|
| | Fmoc-L-2-pyridylalanine Basic information |
| | Fmoc-L-2-pyridylalanine Chemical Properties |
| Melting point | 151 °C | | Boiling point | 514.13°C (rough estimate) | | density | 1.2692 (rough estimate) | | refractive index | 1.6300 (estimate) | | storage temp. | 2-8°C | | solubility | Dichloromethane (Sparingly), Dimethylformamide (Slightly, Sonicated) | | form | Powder | | pka | 2.98±0.10(Predicted) | | color | Pale brown | | Major Application | peptide synthesis | | InChI | InChI=1/C23H20N2O4/c26-22(27)21(13-15-7-5-6-12-24-15)25-23(28)29-14-20-18-10-3-1-8-16(18)17-9-2-4-11-19(17)20/h1-12,20-21H,13-14H2,(H,25,28)(H,26,27)/t21-/s3 | | InChIKey | DXIVJCDZOMUITR-NRFANRHFSA-N | | SMILES | C1(COC(=O)N[C@H](C(=O)O)CC2N=CC=CC=2)C2C=CC=CC=2C2C=CC=CC1=2 |&1:6,r| | | CAS DataBase Reference | 185379-40-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29223900 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-L-2-pyridylalanine Usage And Synthesis |
| Chemical Properties | white to light yellow powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-L-2-pyridylalanine Preparation Products And Raw materials |
|