| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3,5-Dimethyl-2-hydroxymethyl-4-nitropyridine Basic information |
| Product Name: | 3,5-Dimethyl-2-hydroxymethyl-4-nitropyridine | | Synonyms: | 3,5-DIMETHYL-2-HYDROXYMETHYL-4-NITROPYRIDINE;(3,5-DIMETHYL-4-NITRO-2-PYRIDYL)METHAN-1-OL;3,5-(DIMETHYL-4-NITRO-2-PYRIDYL)METHANOL;3,5-DIMETHYL-4-NITROPYRIDINE-2-METHANOL;2-HYDROXYMETHYL-3,5-DIMETHYL-4-NITROPYRIDINE;Esomeprazole Impurity 63;3,5-Dimethyl-4-Nitro-2-Hydroxymethyl Pyridine;2-hydromethyl-3,5-dimethyl-4-nitro-pyridine | | CAS: | 149082-03-1 | | MF: | C8H10N2O3 | | MW: | 182.18 | | EINECS: | 604-675-8 | | Product Categories: | Pyridines derivates;C7 and C8;Heterocyclic Building Blocks;Pyridines;OLED materials,pharm chemical,electronic | | Mol File: | 149082-03-1.mol |  |
| | 3,5-Dimethyl-2-hydroxymethyl-4-nitropyridine Chemical Properties |
| Melting point | 66-70 °C (lit.) | | Boiling point | 349.7±37.0 °C(Predicted) | | density | 1.293±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 12.97±0.10(Predicted) | | color | White to Gray to Brown | | InChI | 1S/C8H10N2O3/c1-5-3-9-7(4-11)6(2)8(5)10(12)13/h3,11H,4H2,1-2H3 | | InChIKey | KBCDOXSSYLFMHH-UHFFFAOYSA-N | | SMILES | Cc1cnc(CO)c(C)c1[N+]([O-])=O | | CAS DataBase Reference | 149082-03-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,5-Dimethyl-2-hydroxymethyl-4-nitropyridine Usage And Synthesis |
| | 3,5-Dimethyl-2-hydroxymethyl-4-nitropyridine Preparation Products And Raw materials |
|