|
|
| | 4,5,6-Triaminopyrimidine Basic information |
| Product Name: | 4,5,6-Triaminopyrimidine | | Synonyms: | PYRIMIDINE-4,5,6-TRIAMINE;TIMTEC-BB SBB004267;pyrimidine-4,5,6-triyltriamine;4,5,6-Pyrimidinetriamine;NSC-145059;4,5,6-Triaminopyrimidine,>97%;4,5,6-TRIAMINOPYRIMIDINE ISO 9001:2015 REACH;4,5,6-Triaminopyrimidine | | CAS: | 118-70-7 | | MF: | C4H7N5 | | MW: | 125.13 | | EINECS: | 204-270-2 | | Product Categories: | pyrimidine;Heterocycle-Pyrimidine series | | Mol File: | 118-70-7.mol |  |
| | 4,5,6-Triaminopyrimidine Chemical Properties |
| Melting point | 257 °C (decomp)(Solv: water (7732-18-5)) | | Boiling point | 406.2±40.0 °C(Predicted) | | density | 1.512±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 5.60±0.30(Predicted) | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C4H7N5/c5-2-3(6)8-1-9-4(2)7/h1H,5H2,(H4,6,7,8,9) | | InChIKey | MPNBXFXEMHPGTK-UHFFFAOYSA-N | | SMILES | C1=NC(N)=C(N)C(N)=N1 | | CAS DataBase Reference | 118-70-7 |
| | 4,5,6-Triaminopyrimidine Usage And Synthesis |
| Uses | 4,5,6-Triaminopyrimidine (pyrimidine-4,5,6-triamine) is a pyrimidine derivative. It can be used in the preparation of 5-pyrimidine-6-yloxypyrazole and pyrazole derivatives, as well as in the preparation of nanofiltration membranes and surface-modified substrates for compounds. | | Synthesis | Step 4: Wetted 4,6-diamino-5-nitrosopyrimidine was loaded into a reaction column. 400 mL of methanol and 4 g of 5% palladium carbon catalyst were added to the autoclave and the reaction was stirred at room temperature in a hydrogen atmosphere. Upon completion of the reaction, methanol was removed by evaporating the filtrate. The resulting 4,5,6-triaminopyrimidine can be used directly in the subsequent reaction steps without further purification in 95% yield. | | References | [1] Nucleosides, Nucleotides and Nucleic Acids, 2009, vol. 28, # 5-7, p. 550 - 585 [2] Patent: CN103709164, 2016, B. Location in patent: Paragraph 0034; 0105; 0110-0111 [3] Journal of the Chemical Society, 1956, p. 4106,4111 |
| | 4,5,6-Triaminopyrimidine Preparation Products And Raw materials |
| Raw materials | Sulfuric acid-->Sodium-->Sodium nitrite-->Sodium dithionite-->Ethyl formate-->2-Aminoacetamidine-->4,6-Pyrimidinediamine, 5-[2-(4-nitrophenyl)diazenyl]--->Propanedinitrile, 2-[2-(4-methylphenyl)diazenyl]--->4,6-Diamino-2-mercapto-5-nitrosopyrimidine-->5-phenylazopyrimidine-4,6-diamine-->1H-Purin-6-amine, 8-methyl- (9CI)-->4,6-Pyrimidinediamine, 5-nitroso- (9CI)-->2-Mercapto-4,5,6-triaminopyrimidine-->4,6-Diamino-5-nitropyrimidine-->4,5,6-Triaminopyrimidine sulfate | | Preparation Products | 6-Amino-2-bromopurine-->4,6-Diaminopyrimidine |
|