|
|
| | 3,4-Dimethoxybenzyl chloride Basic information |
| Product Name: | 3,4-Dimethoxybenzyl chloride | | Synonyms: | 3,4-DIMETHOXYBENZYL CHLORIDE;3,4-bis(methoxy)-benzylchloride;4-(chloromethyl)-1,2-dimethoxy-benzen;alpha-chloro-3,4-dimethoxy-toluen;alpha-chloro-3,4-dimethoxytoluene;veratrylchlorid;veratrylchloride;3,4-Dimethoxybenzylcholoride | | CAS: | 7306-46-9 | | MF: | C9H11ClO2 | | MW: | 186.64 | | EINECS: | 230-756-9 | | Product Categories: | Catechol Derivatives | | Mol File: | 7306-46-9.mol |  |
| | 3,4-Dimethoxybenzyl chloride Chemical Properties |
| Melting point | 50-53 °C(lit.) | | Boiling point | 266.98°C (rough estimate) | | density | 1.1631 (rough estimate) | | refractive index | 1.5080 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C9H11ClO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,6H2,1-2H3 | | InChIKey | WWHJLVMBXXXUFO-UHFFFAOYSA-N | | SMILES | C1(OC)=CC=C(CCl)C=C1OC | | CAS DataBase Reference | 7306-46-9(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1759 8/PG 2 | | RTECS | XS9060000 | | HS Code | 2909309090 |
| | 3,4-Dimethoxybenzyl chloride Usage And Synthesis |
| Uses | 3,4-Dimethoxybenzyl chloride is an intermediate of tetrahydrobarmaline (tetrahydrobarmaline). | | Synthesis Reference(s) | The Journal of Organic Chemistry, 40, p. 1191, 1975 DOI: 10.1021/jo00897a001 |
| | 3,4-Dimethoxybenzyl chloride Preparation Products And Raw materials |
|