5-(Chloromethyl)-1,2,3-trimethoxybenzene manufacturers
|
| | 5-(Chloromethyl)-1,2,3-trimethoxybenzene Basic information |
| Product Name: | 5-(Chloromethyl)-1,2,3-trimethoxybenzene | | Synonyms: | 5-(CHLOROMETHYL)PYROGALLOL TRIMETHYL ETHER;5-(chloromethyl)-1,2,3-trimethoxybenzene;3,4,5-TRIMETHOXYBENZYL CHLORIDE;Benzene, 5-(chloromethyl)-1,2,3-trimethoxy-;3,4,5-Trimethoxybenzyl chloride 97%;1,2,3-Trimethoxy-5-(chloromethyl)benzene;5-(Chloromethyl)-1,2,3-trimethoxybenzene, alpha-Chloro-3,4,5-trimethoxytoluene;3,4,5-Trimethoxybenzyl chloride
5-(chlormethyl)-1,2,3-trimethoxybenzene | | CAS: | 3840-30-0 | | MF: | C10H13ClO3 | | MW: | 216.66 | | EINECS: | 223-330-9 | | Product Categories: | fine chemicals, specialty chemicals, intermediates, electronic chemical, organic synthesis;Aromatic Halides (substituted) | | Mol File: | 3840-30-0.mol |  |
| | 5-(Chloromethyl)-1,2,3-trimethoxybenzene Chemical Properties |
| Melting point | 60-63 °C | | Boiling point | 110 °C(Press: 0.1 Torr) | | density | 1.145±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | methanol: 0.1 g/mL, clear | | form | crystalline solid | | color | Faint beige/light brown | | BRN | 911181 | | InChI | InChI=1S/C10H13ClO3/c1-12-8-4-7(6-11)5-9(13-2)10(8)14-3/h4-5H,6H2,1-3H3 | | InChIKey | XXRUQNNAKXZSOS-UHFFFAOYSA-N | | SMILES | C1(OC)=CC(CCl)=CC(OC)=C1OC | | CAS DataBase Reference | 3840-30-0(CAS DataBase Reference) | | NIST Chemistry Reference | 3,4,5-Trimethoxybenzyl chloride(3840-30-0) |
| Hazard Codes | C,Xi | | Risk Statements | 34-37 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-19-21 | | Hazard Note | Irritant | | HazardClass | IRRITANT, LACHRYMATOR, CORROSIVE | | HS Code | 2909309090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 5-(Chloromethyl)-1,2,3-trimethoxybenzene Usage And Synthesis |
| | 5-(Chloromethyl)-1,2,3-trimethoxybenzene Preparation Products And Raw materials |
| Raw materials | 1,2,3-Trimethoxy-5-(methoxymethyl)benzene-->4-HYDROXY-3,5-DIMETHOXYBENZYL ALCOHOL-->Methyl 3,4,5-trimethoxybenzoate-->3,4,5-Trimethoxy benzoic acid-->3,4,5-Trimethoxybenzyl alcohol-->Formaldehyde-->1,2,3-Trimethoxybenzene-->3,4,5-Trimethoxybenzaldehyde | | Preparation Products | 5-BROMOMETHYL-1,2,3-TRIMETHOXY-BENZENE-->Triphenyl-[(3,4,5-trimethoxyphenyl)-methyl]-phosphonium chloride |
|