| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2,4-Dichloro-5-nitrobenzotrifluoride Basic information |
| | 2,4-Dichloro-5-nitrobenzotrifluoride Chemical Properties |
| Melting point | 55-57 °C (lit.) | | Boiling point | 264.9±35.0 °C(Predicted) | | density | 1.6589 (estimate) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | Insoluble in water | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | BRN | 2467459 | | InChI | InChI=1S/C7H2Cl2F3NO2/c8-4-2-5(9)6(13(14)15)1-3(4)7(10,11)12/h1-2H | | InChIKey | VLVNHMVSVDVAOA-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C1=CC([N+]([O-])=O)=C(Cl)C=C1Cl | | CAS DataBase Reference | 400-70-4(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-37/39-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, IRRITANT-HARMFUL | | HS Code | 29049090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,4-Dichloro-5-nitrobenzotrifluoride Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2,4-Dichloro-5-nitrobenzotrifluoride has been used in the synthesis of:
- 2-substituted 3,7,8-trichlorodibenzo-p-dioxins
- new substituted 10 H-phenothiazines
|
| | 2,4-Dichloro-5-nitrobenzotrifluoride Preparation Products And Raw materials |
|