| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2',3'-Dideoxyguanosine Basic information |
| | 2',3'-Dideoxyguanosine Chemical Properties |
| density | 1.91±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | form | Powder | | pka | 9+-.0.20(Predicted) | | color | White to Off-white | | InChI | InChI=1S/C10H13N5O3/c11-10-13-8-7(9(17)14-10)12-4-15(8)6-2-1-5(3-16)18-6/h4-6,16H,1-3H2,(H3,11,13,14,17)/t5-,6+/m0/s1 | | InChIKey | OCLZPNCLRLDXJC-UHFFFAOYSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3=C(C(NC(=N3)N)=O)N=C2)CC1 | | CAS DataBase Reference | 85326-06-3(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29339900 |
| | 2',3'-Dideoxyguanosine Usage And Synthesis |
| Chemical Properties | Solid | | Uses | 2’-3’-Dideoxyguanosine is modified and evaluated for their anti-HIV activities and cytotoxicity in cell-based assays. |
| | 2',3'-Dideoxyguanosine Preparation Products And Raw materials |
|