| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
1-METHYLGUANOSINE manufacturers
|
| | 1-METHYLGUANOSINE Basic information |
| Product Name: | 1-METHYLGUANOSINE | | Synonyms: | 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1-methyl-1,9-dihydropurin-6-one;1-Methyl-2-amino-9-(β-D-ribofuranosyl)-9H-purine-6(1H)-one;1-Methyl-2-amino-9-β-D-ribofuranosyl-9H-purine-6(1H)-one;Guanosine, 1-methyl- (8ci)(9ci);N1-Methylguanosine;Nsc 70897;RNA-modified nucleoside m1G;1-METHYLGUANOSINE | | CAS: | 2140-65-0 | | MF: | C11H15N5O5 | | MW: | 297.27 | | EINECS: | | | Product Categories: | | | Mol File: | 2140-65-0.mol |  |
| | 1-METHYLGUANOSINE Chemical Properties |
| Melting point | 163 °C | | Boiling point | 737.4±70.0 °C(Predicted) | | density | 2.02±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | pka | 13.22±0.70(Predicted) | | color | White to Off-White | | PH | ~2.4 | | λmax | 258 (pH 1)；256 (pH 6) | | Stability: | Hygroscopic | | InChI | InChI=1S/C11H15N5O5/c1-15-9(20)5-8(14-11(15)12)16(3-13-5)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14)/t4-,6-,7-,10-/m1/s1 | | InChIKey | UTAIYTHAJQNQDW-KQYNXXCUSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3=C(C(N(C)C(=N3)N)=O)N=C2)[C@H](O)[C@@H]1O |
| | 1-METHYLGUANOSINE Usage And Synthesis |
| Uses | N1-Methylguanosine-CD3 is the labeled form of N1-Methylguanosine(B426593), which ic use in methods for increasing capping efficiency of transcribed RNA. | | Definition | ChEBI: Guanosine substituted with a methyl group at position N-1. |
| | 1-METHYLGUANOSINE Preparation Products And Raw materials |
|