| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Bromo-pyrazolo[1,5-a]pyridine Basic information |
| | 3-Bromo-pyrazolo[1,5-a]pyridine Chemical Properties |
| Melting point | 55 °C(Solv: ligroine (8032-32-4)) | | density | 1.69±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 0.56±0.30(Predicted) | | Appearance | Off-white to gray Solid | | InChI | InChI=1S/C7H5BrN2/c8-6-5-9-10-4-2-1-3-7(6)10/h1-5H | | InChIKey | NMPZEHJXHWTZNI-UHFFFAOYSA-N | | SMILES | C12=C(Br)C=NN1C=CC=C2 |
| | 3-Bromo-pyrazolo[1,5-a]pyridine Usage And Synthesis |
| Uses | 3-Bromopyrazolo[1,5-a]pyridine is used as a pharmaceutical intermediate compound for the preparation of Hpk1 antagonists. | | Synthesis | The general procedure for the synthesis of 3-bromopyrazolo[1,5-a]pyridine-3-carboxylic acid from pyrazolo[1,5-a]pyridine was as follows: N-bromosuccinimide (3.06 g, 17.22 mmol) and sodium bicarbonate (4.34 g, 51.66 mmol) were sequentially added to a N,N-dimethylformamide (40 mL) solution of pyrazolo[1,5-a]pyridine-3-carboxylic acid (2.81 g, 17.22 mmol) in a solution of N,N-dimethylformamide (40 mL). The reaction mixture was stirred at room temperature for 4 h and then poured into water (100 mL). The resulting suspension was extracted twice with ethyl acetate and the organic layers were combined and dried over anhydrous magnesium sulfate. After filtration, the solvent was removed by concentration under reduced pressure. The crude product was purified by fast column chromatography (eluent: hexane/ethyl acetate = 8:2) to afford the target product 3-bromopyrazolo[1,5-a]pyridine (2.58 g, 76% yield). Mass spectrum (LRMS) showed m/z: 197 ([M+1]+). 1H-NMR (250 MHz, CDCl3) δ: 6.8 (t, 1H), 7.2 (t, 1H), 7.5 (d, 1H), 7.9 (s, 1H), 8.4 (d, 1H). | | References | [1] Patent: WO2011/101161, 2011, A1. Location in patent: Page/Page column 99 |
| | 3-Bromo-pyrazolo[1,5-a]pyridine Preparation Products And Raw materials |
|