|
|
| | 5-METHYLINDOLE-2-CARBOXYLIC ACID Basic information |
| | 5-METHYLINDOLE-2-CARBOXYLIC ACID Chemical Properties |
| Melting point | 236-238°C (dec.) | | Boiling point | 236 °C(Press: 4.0 Torr) | | density | 1.340±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 4.48±0.30(Predicted) | | Appearance | Off-white to light brown Solid | | Water Solubility | Soluble in ethanol (50 mg/ml). Insoluble in water. | | BRN | 144055 | | InChI | InChI=1S/C10H9NO2/c1-6-2-3-8-7(4-6)5-9(11-8)10(12)13/h2-5,11H,1H3,(H,12,13) | | InChIKey | DAITVOCMWPNFTL-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(C)C=C2)C=C1C(O)=O | | CAS DataBase Reference | 10241-97-1(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 13 - Non Combustible Solids |
| | 5-METHYLINDOLE-2-CARBOXYLIC ACID Usage And Synthesis |
| Chemical Properties | Light brown powder | | Uses | 5-Methylindole-2-carboxylic acid is a compound used in the synthesis of Pin1 inhibitors as potential antitumor agents. reactant in preparation of Pin1 inhibitors as potential antitumor agents reactant in preparation of non-imidazole human histamine H4 receptor antagonists |
| | 5-METHYLINDOLE-2-CARBOXYLIC ACID Preparation Products And Raw materials |
|