| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Amino-4-hydroxyquinoline hydrate Basic information |
| | 2-Amino-4-hydroxyquinoline hydrate Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 385.3±22.0 °C(Predicted) | | density | 1.363±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.63±0.40(Predicted) | | Appearance | Light brown to gray Solid | | BRN | 124785 | | InChI | InChI=1S/C9H8N2O/c10-9-5-8(12)6-3-1-2-4-7(6)11-9/h1-5H,(H3,10,11,12) | | InChIKey | LWGUCIXHBVVATR-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2)C(O)=CC=1N | | CAS DataBase Reference | 42712-64-1(CAS DataBase Reference) | | EPA Substance Registry System | 4-Quinolinol, 2-amino- (42712-64-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 2933499090 |
| Provider | Language |
|
ALFA
| English |
| | 2-Amino-4-hydroxyquinoline hydrate Usage And Synthesis |
| Uses | 2-Aminoquinolin-4-ol is a useful reagent used in the preparation of quinazolines and quinazolines derivatives. |
| | 2-Amino-4-hydroxyquinoline hydrate Preparation Products And Raw materials |
|