|
|
| | 1,3-Bis(2,6-di-I-propylphenyl)imidazol-2-ylidene Basic information |
| Product Name: | 1,3-Bis(2,6-di-I-propylphenyl)imidazol-2-ylidene | | Synonyms: | 1,3-Bis(2,6-di-i-propylphenyl)imidazol-2-ylidene,min.98%;1,3-BIS(2,6-DI-I-PROPYLPHENYL)IMIDAZOL-2-YLIDENE, MIN. 98%;N,N'-Bis(2,6-diisopropylphenyl)imidazol-2-ylidene;1,3-Bis(2,6-diisopropylphenyl)-1,3-dihydro-2H-iMidazol-2-ylidene 97%;1,3-Bis(2,6-di-i-propylphenyl)imidazol-2-ylidene,98%;1,3-Bis(2,6-di-i-propylphenyl)imidazol-2-ylidene >98.0%(HPLC );1,3-bis(2,6-diphenylmethyl-4-methylphenyl-imidazol-2-ylidene;N,N'-1,3-Bis(2,6-diisopropylphenyl)imidazol-2-ylidene | | CAS: | 244187-81-3 | | MF: | C27H36N2** | | MW: | 388.59 | | EINECS: | | | Product Categories: | N-heterocyclic carbene | | Mol File: | 244187-81-3.mol |  |
| | 1,3-Bis(2,6-di-I-propylphenyl)imidazol-2-ylidene Chemical Properties |
| Melting point | 213-217 °C | | storage temp. | -20°C | | solubility | soluble in Methanol | | form | Powder | | color | white to off-white | | Sensitive | air sensitive, moisture sensitive | | InChI | InChI=1S/C27H36N2/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8/h9-16,18-21H,1-8H3 | | InChIKey | VYCIHDBIKGRENI-UHFFFAOYSA-N | | SMILES | N1(C=CN(C2C(=CC=CC=2C(C)C)C(C)C)[C]1)C1C(=CC=CC=1C(C)C)C(C)C |^3:16| | | CAS DataBase Reference | 244187-81-3 |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | 1325 | | WGK Germany | 3 | | HS Code | 29332900 | | Storage Class | 11 - Combustible Solids |
| | 1,3-Bis(2,6-di-I-propylphenyl)imidazol-2-ylidene Usage And Synthesis |
| Uses | Ligand for Pd complexes for amination reaction of aryl halides; used as C-C bond formation reaction, e.g. Kumada-Tamao-Corriu reaction, Suzuki coupling, and Stille coupling. | | reaction suitability | reagent type: ligand |
| | 1,3-Bis(2,6-di-I-propylphenyl)imidazol-2-ylidene Preparation Products And Raw materials |
|