|
|
| | Chloro[1,3-bis(2,6-di-I-propylphenyl)imidazol-2-ylidene]copper(I) Basic information | | Reaction |
| Product Name: | Chloro[1,3-bis(2,6-di-I-propylphenyl)imidazol-2-ylidene]copper(I) | | Synonyms: | 1,3-Bis(2,6-diisopropylphenyl)-2,3-dihydro-2-imidazolyl]copper(I) Chloride;[1,3-Bis(2,6-diisopropylphenyl)-1,3-dihydro-2H-imidazol-2-ylidene](chloro)copper;[1,3-Bis(2,6-diisopropylphenyl)imidazol-2-ylidene]copper chloride;Chloro[1,3-bis(2,6-diisopropylphenyl)iMidazol-2-ylidene]copp;Chloro[1,3-bis(2,6-di-i-propylphenyl)imidazol-2-ylidene]copper(I),98%;[1,3-Bis(2,6-diisopropylphenyl)imidazol-2-ylidene]copper(I) chloride;Chloro[1,3-bis(2,6-diisopropylphenyl)imidazol-2-ylidene]copper(I);idene]copper(I) | | CAS: | 578743-87-0 | | MF: | C27H36ClCuN2*- | | MW: | 487.58714 | | EINECS: | | | Product Categories: | Cu;Catalysis and Inorganic Chemistry;Chemical Synthesis;Copper;organometallic complex | | Mol File: | 578743-87-0.mol | ![Chloro[1,3-bis(2,6-di-I-propylphenyl)imidazol-2-ylidene]copper(I) Structure](CAS/GIF/578743-87-0.gif) |
| | Chloro[1,3-bis(2,6-di-I-propylphenyl)imidazol-2-ylidene]copper(I) Chemical Properties |
| Melting point | >300 °C | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | white | | Sensitive | air sensitive | | InChI | InChI=1S/C27H36N2.ClH.Cu/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;;/h9-16,18-21H,1-8H3;1H;/q;;+1/p-1 | | InChIKey | JPUFNIIPFXQOCB-UHFFFAOYSA-M | | SMILES | N1(C=CN(C2C(=CC=CC=2C(C)C)C(C)C)C1=[Cu]Cl)C1=C(C=CC=C1C(C)C)C(C)C |
| WGK Germany | 3 | | HS Code | 2933299090 | | Storage Class | 11 - Combustible Solids |
| | Chloro[1,3-bis(2,6-di-I-propylphenyl)imidazol-2-ylidene]copper(I) Usage And Synthesis |
| Reaction |
- Catalyst for the aziridination of olefins.
- Mild catalyst, superior to CuCl, in the methylenetriphenylphosphorane methyleneation of aldehydes and ketones.
- Copper(I) catalyzed alkylation of aryl and alkenylsilanes.
- Copper-catalyzed formal methylative and hydrogenative carboxylation of alkynes with carbon dioxide.
- Regioselective copper-catalyzed carboxylation of allylboronates with carbon dioxide.
- Carboxylation of organoboronic esters with potassium methyl carbonate under copper catalysis.
- Catalytic anti-Markovnikov hydrobromination of alkynes.
- Copper-catalyzed borylative cross-coupling of allenes and imines.
| | Uses | "Use for reduction of olefin and carbonyl, carbene transfer reaction, aziridination of olefins, and methyleneation of aldehydes." | | reaction suitability | core: copper
reagent type: catalyst |
| | Chloro[1,3-bis(2,6-di-I-propylphenyl)imidazol-2-ylidene]copper(I) Preparation Products And Raw materials |
|