| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (1R,2R)-2-Amino-1,2-diphenylethanol, 97 Basic information |
| Product Name: | (1R,2R)-2-Amino-1,2-diphenylethanol, 97 | | Synonyms: | (R,R)-(+)-2-Amino-1,2-diphenylethanol >=99.5% (HPLC);(1R,2R)-2-amino-1,2-diphenylethanol(WX180059);Benzeneethanol, β-amino-α-phenyl-, (αR,βR)-;(1R,2R)-2-AMINO-1,2-DIPHENYLETHANOL, 97 USP/EP/BP;(R,R)-(+)-2-Amino-1,2-diphenylethanol;(1R,2R)-2-amino-1,2-diphenylethan-1-ol;(R,R)-(+)-2-Amino-1,2-diphenylethanol;RS RMA04445 | | CAS: | 88082-66-0 | | MF: | C14H15NO | | MW: | 213.27 | | EINECS: | | | Product Categories: | Amino Alcohols;Chiral Building Blocks;Organic Building Blocks | | Mol File: | 88082-66-0.mol |  |
| | (1R,2R)-2-Amino-1,2-diphenylethanol, 97 Chemical Properties |
| Melting point | 143-147 °C(lit.) | | Boiling point | 374.3±37.0 °C(Predicted) | | density | 1.148±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.70±0.45(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]/D +124±3°, c = 0.87 in ethanol | | BRN | 1212829 | | InChI | InChI=1/C14H15NO/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14,16H,15H2/t13-,14-/s3 | | InChIKey | GEJJWYZZKKKSEV-HCTHJJLONA-N | | SMILES | [C@@H](O)(C1=CC=CC=C1)[C@H](N)C1=CC=CC=C1 |&1:0,8,r| |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | (1R,2R)-2-Amino-1,2-diphenylethanol, 97 Usage And Synthesis |
| | (1R,2R)-2-Amino-1,2-diphenylethanol, 97 Preparation Products And Raw materials |
|