|
|
| | 3,5-DIMETHOXYPHENYLACETIC ACID Basic information |
| | 3,5-DIMETHOXYPHENYLACETIC ACID Chemical Properties |
| Melting point | 102-103 °C(lit.) | | Boiling point | 293.08°C (rough estimate) | | density | 1.2166 (rough estimate) | | refractive index | 1.5430 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.08±0.10(Predicted) | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C10H12O4/c1-13-8-3-7(5-10(11)12)4-9(6-8)14-2/h3-4,6H,5H2,1-2H3,(H,11,12) | | InChIKey | FFPAFDDLAGTGPQ-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC(OC)=CC(OC)=C1 | | CAS DataBase Reference | 4670-10-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36/37 | | Safety Statements | 26-36-36/37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 STOT SE 3 |
| | 3,5-DIMETHOXYPHENYLACETIC ACID Usage And Synthesis |
| Chemical Properties | brown powder | | Uses | 3,5-Dimethoxyphenylacetic Acid is a general reactant/reagent used in the synthesis of a recyclable, immobilized analogue of Benzotetramisole. | | Definition | ChEBI: 2-(3,5-dimethoxyphenyl)acetic acid is a dimethoxybenzene. | | General Description | (3,5-Dimethoxyphenyl)acetic acid is a carboxylic acid. Its physical properties like density, freezing point, boiling point and refractive index have been determined. |
| | 3,5-DIMETHOXYPHENYLACETIC ACID Preparation Products And Raw materials |
|