|
|
| | 1-Bromo-2,6-difluorobenzene Basic information |
| Product Name: | 1-Bromo-2,6-difluorobenzene | | Synonyms: | 2,6-Difluorobromobenzene
2-Bromo-1,3-difluorobenzene;2,6-DIFLUOROBROMOBENZENE;1-BROMO-2,6-DIFLUOROBENZENE;1-Bromo-2,6-difluorobenzene 98%;1-Bromo-2,6-difluorobenzene98%;Benzene,2-bromo-1,3-difluoro-;1-Bromo-2,6-difluoro;2,6-Difluorobromobenzene 98% | | CAS: | 64248-56-2 | | MF: | C6H3BrF2 | | MW: | 192.99 | | EINECS: | 264-750-2 | | Product Categories: | Organic Building Blocks;Organic Fluorinated Building Blocks;Other Fluorinated Organic Building Blocks;Aryl Fluorinated Building Blocks;Building Blocks;Chemical Synthesis;Fluorinated Building Blocks;Halogenated Hydrocarbons;Aryl;Halogenated Hydrocarbons;Fluorobenzene;Aromatic Halides (substituted);Miscellaneous;Bromine Compounds;Fluorine Compounds;C6 | | Mol File: | 64248-56-2.mol |  |
| | 1-Bromo-2,6-difluorobenzene Chemical Properties |
| Melting point | 20 °C | | Boiling point | 61 °C (35 mmHg) | | density | 1.71 | | refractive index | n20/D 1.51(lit.) | | Fp | 128 °F | | storage temp. | Sealed in dry,2-8°C | | form | Liquid | | color | Clear yellow | | BRN | 1681053 | | InChI | InChI=1S/C6H3BrF2/c7-6-4(8)2-1-3-5(6)9/h1-3H | | InChIKey | HRZTZLCMURHWFY-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC(F)=C1Br | | CAS DataBase Reference | 64248-56-2(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 2-bromo-1,3-difluoro-(64248-56-2) |
| Hazard Codes | Xi,F | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36/37/39-37/39 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Flammable | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Skin Irrit. 2
STOT SE 3 |
| | 1-Bromo-2,6-difluorobenzene Usage And Synthesis |
| Chemical Properties | clean yellow liquid | | Uses | 1-Bromo-2,6-difluorobenzene has been used in the synthesis of tris(fluorophenyl)boranes. | | General Description | Three-component coupling reaction of 1-bromo-2,6-difluorobenzene with benzyne and isocyanides has been reported. |
| | 1-Bromo-2,6-difluorobenzene Preparation Products And Raw materials |
|