| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Bromo-4,5-difluorophenol Basic information |
| Product Name: | 2-Bromo-4,5-difluorophenol | | Synonyms: | 2-Bromo-4,5-difluorophenol 97%;2-Bromo-4,5-difluorophenol97%;2-BROMO-4,5-DIFLUOROPHENOL;2-BROMO-4,5-DIFLOUO PHENOL;2-Bromo-4,5-difluorophen;2-Bromo-4,5-difluoro;2-BroMo-4,5-difluorophenol, 98%+;2-Bromo-4,5-difluorophenol > | | CAS: | 166281-37-4 | | MF: | C6H3BrF2O | | MW: | 208.99 | | EINECS: | | | Product Categories: | Pyridines ,Halogenated Heterocycles;Aromatic Phenols;Phenol&Thiophenol&Mercaptan;Bromine Compounds;Fluorine Compounds;Phenols;Organic Building Blocks;Oxygen Compounds | | Mol File: | 166281-37-4.mol |  |
| | 2-Bromo-4,5-difluorophenol Chemical Properties |
| Boiling point | 208.8±35.0 °C(Predicted) | | density | 1.829 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.531(lit.) | | Fp | 178 °F | | storage temp. | Store at room temperature | | form | clear liquid | | pka | 7.46±0.23(Predicted) | | color | Colorless to Yellow | | BRN | 8355005 | | InChI | InChI=1S/C6H3BrF2O/c7-3-1-4(8)5(9)2-6(3)10/h1-2,10H | | InChIKey | FCYZOOHWUOEAOX-UHFFFAOYSA-N | | SMILES | C1(O)=CC(F)=C(F)C=C1Br | | CAS DataBase Reference | 166281-37-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN2811 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HS Code | 29081990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Bromo-4,5-difluorophenol Usage And Synthesis |
| Chemical Properties | Colorless to yellow liquid | | Uses | 2-Bromo-4,5-difluorophenol is reported to undergo palladium-catalyzed cyclotrimerization to yield hexafluoro- and trimethoxytriphenylene derivatives. | | General Description | 2-Bromo-4,5-difluorophenol is reported to undergo palladium-catalyzed cyclotrimerization to yield hexafluoro- and trimethoxytriphenylene derivatives. |
| | 2-Bromo-4,5-difluorophenol Preparation Products And Raw materials |
|