|
|
| | 4,7,10,13,16-Pentaoxanonadec-18-ynoic acid, 2,3,4,5,6-pentafluorophenyl ester Basic information |
| Product Name: | 4,7,10,13,16-Pentaoxanonadec-18-ynoic acid, 2,3,4,5,6-pentafluorophenyl ester | | Synonyms: | 4,7,10,13,16-Pentaoxanonadec-18-ynoic acid, 2,3,4,5,6-pentafluorophenyl ester;Perfluorophenyl 4,7,10,13,16-pentaoxanonadec-18-yn-1-oate | | CAS: | 2148295-92-3 | | MF: | C20H23F5O7 | | MW: | 470.38 | | EINECS: | | | Product Categories: | | | Mol File: | 2148295-92-3.mol |  |
| | 4,7,10,13,16-Pentaoxanonadec-18-ynoic acid, 2,3,4,5,6-pentafluorophenyl ester Chemical Properties |
| Boiling point | 485.4±45.0 °C(Predicted) | | density | 1.300±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C20H23F5O7/c1-2-4-27-6-8-29-10-12-31-13-11-30-9-7-28-5-3-14(26)32-20-18(24)16(22)15(21)17(23)19(20)25/h1H,3-13H2 | | InChIKey | NWISPSNLWMLYFW-UHFFFAOYSA-N | | SMILES | C(OC1=C(F)C(F)=C(F)C(F)=C1F)(=O)CCOCCOCCOCCOCCOCC#C |
| | 4,7,10,13,16-Pentaoxanonadec-18-ynoic acid, 2,3,4,5,6-pentafluorophenyl ester Usage And Synthesis |
| Uses | Propargyl-PEG5-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Propargyl-PEG5-PFP ester is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | 4,7,10,13,16-Pentaoxanonadec-18-ynoic acid, 2,3,4,5,6-pentafluorophenyl ester Preparation Products And Raw materials |
|