| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- FMOC-D-THR-OH
-
- $10.00
-
2026-03-20
- CAS:157355-81-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- FMOC-D-THR-OH
-
- $50.00
-
2024-04-27
- CAS:157355-81-2
- Min. Order: 1kg
- Purity: 99.10%
- Supply Ability: 50000kg
- FMOC-D-THR-OH
-
- $1.00
-
2020-01-09
- CAS:157355-81-2
- Min. Order: 1g
- Purity: ≥98%
|
| | (((9H-Fluoren-9-yl)methoxy)carbonyl)-D-threonine Basic information |
| Product Name: | (((9H-Fluoren-9-yl)methoxy)carbonyl)-D-threonine | | Synonyms: | n-fmoc-d-threonine;N-Fmoc-D-threonine
Fmoc-D-Thr-OH;N-[(9H-Fluoren-9-ylMethoxy)carbonyl]-D-threonine;FMOC-D-THREONINE extrapure;(2R,3S)-3-(2-{4-[(2S)-2-carboxy-2-[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)acetamido]ethyl]phenoxy}-2-methylpropoxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid;N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-threonine>;D-Threonine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-;(2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoicaci | | CAS: | 157355-81-2 | | MF: | C19H19NO5 | | MW: | 341.36 | | EINECS: | | | Product Categories: | Biochemistry;Fmoc-Amino Acids;Amino Acids;Amino Acids (N-Protected) | | Mol File: | 157355-81-2.mol |  |
| | (((9H-Fluoren-9-yl)methoxy)carbonyl)-D-threonine Chemical Properties |
| Boiling point | 596.5±50.0 °C(Predicted) | | density | 1.327±0.06 g/cm3(Predicted) | | refractive index | 15 ° (C=1, DMF) | | storage temp. | 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.49±0.10(Predicted) | | color | White to Almost white | | Major Application | peptide synthesis | | InChI | 1S/C19H19NO5/c1-11(21)17(18(22)23)20-19(24)25-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,11,16-17,21H,10H2,1H3,(H,20,24)(H,22,23)/t11-,17+/m0/s1 | | InChIKey | OYULCCKKLJPNPU-APPDUMDISA-N | | SMILES | N([C@H]([C@@H](O)C)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 | | CAS DataBase Reference | 157355-81-2 |
| Safety Statements | 24/25 | | WGK Germany | WGK 2 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | (((9H-Fluoren-9-yl)methoxy)carbonyl)-D-threonine Usage And Synthesis |
| Uses | N-Fmoc-D-threonine is an N-Fmoc-protected form of D-Threonine (T405525). D-Threonine is the unnatural isomer of L-Threonine (T405500) and is known to inhibit growth and cell wall synthesis of Mycobacterium smegmatis. D-Threonine is also used as a synthetic intermediate for the production of chiral antibiotics. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | (((9H-Fluoren-9-yl)methoxy)carbonyl)-D-threonine Preparation Products And Raw materials |
|