- INDOPHENOL
-
-
2026-06-30
- CAS:500-85-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- indophenol
-
- $1.00
-
2020-02-02
- CAS:500-85-6
- Min. Order: 1KG
- Purity: Min98%HPLC
|
| | INDOPHENOL Basic information |
| Product Name: | INDOPHENOL | | Synonyms: | N-(P-HYDROXYPHENYL)-P-BENZOQUINONE MONOIMINE;PHENOLINDOPHENOL;INDOPHENOL;4-((4-hydroxyphenyl)imino)-2,5-cyclohexadien-1-one;4-(4-hydroxyphenyl)imino-1-cyclohexa-2,5-dienone;4-((4-hydroxyphenyl)imino)-5-cyclohexadien-1-one;benzenoneindophenol;4-(4-hydroxyphenylimino)cyclohexa-2,5-dienone | | CAS: | 500-85-6 | | MF: | C12H9NO2 | | MW: | 199.21 | | EINECS: | 207-913-5 | | Product Categories: | Miscellaneous;pharmacetical | | Mol File: | 500-85-6.mol |  |
| | INDOPHENOL Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 360.0±42.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | room temp | | solubility | Solubility Insoluble in water; soluble in ethanol | | form | powder | | pka | 8.1, 9.4, 10.6(at 25℃) | | color | Reddish-blue | | PH Range | Red (6.3) to blue (12.3) | | λmax | 602nm | | BRN | 2095656 | | Major Application | Liquid crystal display device, chemical-mechanical polishing, fuel cell, redox materials, hair dyes, lubricants, bacterial vaginosis screening technique, biosensor | | InChI | 1S/C12H9NO2/c14-11-5-1-9(2-6-11)13-10-3-7-12(15)8-4-10/h1-8,14H | | InChIKey | RSAZYXZUJROYKR-UHFFFAOYSA-N | | SMILES | Oc1ccc(cc1)N=C2C=CC(=O)C=C2 | | CAS DataBase Reference | 500-85-6(CAS DataBase Reference) | | EPA Substance Registry System | 2,5-Cyclohexadien-1-one, 4-[(4-hydroxyphenyl)imino]- (500-85-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | GU5778000 | | HS Code | 2907199090 | | Storage Class | 11 - Combustible Solids |
| | INDOPHENOL Usage And Synthesis |
| Uses | Indophenol is an artificial blue metachromatic dye. The formation of Indophenol can be used to determine ammonia and paracetamol by spectrophotometry. Dyes and metabolites. | | Definition | ChEBI: A quinone imine obtained by formal condensation of one of the keto groups of benzoquinone with the amino group of 4-hydroxyaniline. |
| | INDOPHENOL Preparation Products And Raw materials |
|