| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Ethylbenzene-d10, 99.0 atom%D
CAS:25837-05-2
Package:1ML
|
|
| | ETHYLBENZENE-D10 Basic information |
| | ETHYLBENZENE-D10 Chemical Properties |
| Melting point | -95 °C(lit.) | | Boiling point | 134.6 °C(lit.) | | density | 0.949 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.492(lit.) | | Fp | 89 °F | | storage temp. | 2-8°C | | solubility | Acetonitrile (Slightly), Chloroform (Slightly) | | form | Liquid | | color | Clear colorless | | BRN | 1960387 | | InChI | 1S/C8H10/c1-2-8-6-4-3-5-7-8/h3-7H,2H2,1H3/i1D3,2D2,3D,4D,5D,6D,7D | | InChIKey | YNQLUTRBYVCPMQ-CFTAVCBPSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C([2H])([2H])C([2H])([2H])[2H] | | EPA Substance Registry System | Benzene-d5, ethyl-d5- (25837-05-2) | | CAS Number Unlabeled | 100-41-4 |
| | ETHYLBENZENE-D10 Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Ethylbenzene-d10 is a useful compound for selective benzylic C-H monooxygenation mediated by iodine oxides. | | General Description | Ethylbenzene-d10 (d10-ethylbenzene) is a deuterated NMR solvent useful in NMR-based research and analyses. The photodissociation of d10-ethylbenzene at both 193 and 248nm has been studied using vacuum ultraviolet photoionization/multimass ion imaging techniques. The H/D exchange between ethylbenzene-d10 and acidic bridging OH groups in dehydrated zeolites have been investigated in the temperature range of 303 to 393K. |
| | ETHYLBENZENE-D10 Preparation Products And Raw materials |
|