| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Benzene-d5 Basic information |
| | Benzene-d5 Chemical Properties |
| Melting point | 5.5 °C (lit.) | | Boiling point | 80 °C (lit.) | | density | 0.930 g/mL at 25 °C | | refractive index | n20/D 1.498(lit.) | | Fp | 12 °F | | InChI | 1S/C6H6/c1-2-4-6-5-3-1/h1-6H/i1D,2D,3D,4D,5D | | InChIKey | UHOVQNZJYSORNB-RALIUCGRSA-N | | SMILES | [H]c1c([2H])c([2H])c([2H])c([2H])c1[2H] |
| Hazard Codes | F,T | | Risk Statements | 45-46-11-36/38-48/23/24/25-65 | | Safety Statements | 53-45-62-26 | | RIDADR | UN 1114 3/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Chronic 3
Asp. Tox. 1
Carc. 1A
Eye Irrit. 2
Flam. Liq. 2
Muta. 1B
Skin Irrit. 2
STOT RE 1 |
| | Benzene-d5 Usage And Synthesis |
| Uses | Benzene-d5 (CAS# 13657-09-5) is a useful isotopically labeled research compound. |
| | Benzene-d5 Preparation Products And Raw materials |
|