|
|
| | L-Fmoc-Aspartic acid alpha-tert-butyl ester Basic information |
| | L-Fmoc-Aspartic acid alpha-tert-butyl ester Chemical Properties |
| Melting point | 90-98°C | | Boiling point | 617.4±55.0 °C(Predicted) | | density | 1.251±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in water or 1% acetic acid | | pka | 4.08±0.19(Predicted) | | form | powder to crystal | | color | White to Almost white | | Major Application | peptide synthesis | | InChI | 1S/C23H25NO6/c1-23(2,3)30-21(27)19(12-20(25)26)24-22(28)29-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,12-13H2,1-3H3,(H,24,28)(H,25,26)/t19-/m0/s1 | | InChIKey | VZXQYACYLGRQJU-IBGZPJMESA-N | | SMILES | N([C@@H](CC(=O)O)C(=O)OC(C)(C)C)C(=O)OCC1c2c(cccc2)c3c1cccc3 | | CAS DataBase Reference | 129460-09-9(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | WGK 2 water endangering | | HazardClass | IRRITANT | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids |
| | L-Fmoc-Aspartic acid alpha-tert-butyl ester Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Fmoc-Asp-OtBu, is an amino acid building block used in peptide synthesis. With a growing peptide drug market the fast, reliable synthesis of peptides is of great importance. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | L-Fmoc-Aspartic acid alpha-tert-butyl ester Preparation Products And Raw materials |
|