lysylphenylalanine manufacturers
|
| | lysylphenylalanine Basic information |
| | lysylphenylalanine Chemical Properties |
| Boiling point | 571.8±50.0 °C(Predicted) | | density | 1.190±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.40±0.10(Predicted) | | form | solid | | color | White to off-white | | InChI | 1S/C15H23N3O3/c16-9-5-4-8-12(17)14(19)18-13(15(20)21)10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10,16-17H2,(H,18,19)(H,20,21)/t12-,13-/m0/s1 | | InChIKey | QCZYYEFXOBKCNQ-STQMWFEESA-N | | SMILES | OC([C@H](CC1=CC=CC=C1)NC([C@@H](N)CCCCN)=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | lysylphenylalanine Usage And Synthesis |
| Uses | Metabolomics research | | Definition | ChEBI: A dipeptide formed from L-lysine and L-phenylalanine residues. |
| | lysylphenylalanine Preparation Products And Raw materials |
|