|
|
| | 2-(2-PYRIDYL)BENZIMIDAZOLE Basic information |
| | 2-(2-PYRIDYL)BENZIMIDAZOLE Chemical Properties |
| Melting point | 218-220 °C(lit.) | | Boiling point | 321.89°C (rough estimate) | | density | 1.2142 (rough estimate) | | refractive index | 1.6990 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Powder | | pka | pK1:5.58(+1) (25°C,μ=0.16) | | color | Yellow to brown | | Water Solubility | Insoluble in water. | | BRN | 151411 | | InChI | InChI=1S/C12H9N3/c1-2-6-10-9(5-1)14-12(15-10)11-7-3-4-8-13-11/h1-8H,(H,14,15) | | InChIKey | YNFBMDWHEHETJW-UHFFFAOYSA-N | | SMILES | C1(C2=NC=CC=C2)NC2=CC=CC=C2N=1 | | CAS DataBase Reference | 1137-68-4(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 24/25-26 | | WGK Germany | 3 | | HS Code | 29333999 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-(2-PYRIDYL)BENZIMIDAZOLE Usage And Synthesis |
| Chemical Properties | Yellow to brown powder | | Uses | 2-(2-Pyridyl)benzimidazole was used as a chelating fluorescent ligand in the synthesis of cobalt(II) complex. It was also used in the preparation of (H(2)L(1))(2)[Ru(III)Cl(4)(CH(3)CN)(2)](2)[Ru(IV)Cl(4)(CH(3)CN)(2)]·2Cl·6H(2)O complex. |
| | 2-(2-PYRIDYL)BENZIMIDAZOLE Preparation Products And Raw materials |
|