| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,4-Cyclohexanedione mono(2,2-dimethyltrimethylene ketal) Basic information |
| Product Name: | 1,4-Cyclohexanedione mono(2,2-dimethyltrimethylene ketal) | | Synonyms: | 1,4-CYCLOHEXANEDIONE MONONEOPENTYL KETAL;1,4-CYCLOHEXANEDIONE MONO-2,2-DIMETHYLTRIMETHYLENE ACETAL;1,4-CYCLOHEXANEDIONE MONO-2,2-DIMETHYLTRIMETHYLENE KETAL;1,4-Cyclohexanedione mono(2,2-dimethyltrimethylene ketal),98+%;1,4-Cyclohexanedione mono(2,2-dimethyltrimethylene;1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle;3,3-Dimethyl-1,5-dioxaspiro[5.5]undecan-8-one;1,4-Cyclohexanedione Mono-2,2-diMethyltriMetylene ketal | | CAS: | 69225-59-8 | | MF: | C11H18O3 | | MW: | 198.26 | | EINECS: | 273-918-4 | | Product Categories: | Heterocycles;Miscellaneous Reagents;Acetals/Ketals/Ortho Esters;Building Blocks;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds | | Mol File: | 69225-59-8.mol |  |
| | 1,4-Cyclohexanedione mono(2,2-dimethyltrimethylene ketal) Chemical Properties |
| Melting point | 45-50 °C(lit.) | | Boiling point | 70 °C(Press: 0.05 Torr) | | density | 1.08±0.1 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Acetone, Dichloromethane, Ethyl Acetate, Methanol, | | form | Solid | | color | White | | BRN | 3541930 | | InChI | InChI=1S/C11H18O3/c1-10(2)7-13-11(14-8-10)5-3-9(12)4-6-11/h3-8H2,1-2H3 | | InChIKey | COKVDTKAWIFNTH-UHFFFAOYSA-N | | SMILES | O1C2(CCC(=O)CC2)OCC(C)(C)C1 | | CAS DataBase Reference | 69225-59-8(CAS DataBase Reference) |
| | 1,4-Cyclohexanedione mono(2,2-dimethyltrimethylene ketal) Usage And Synthesis |
| Chemical Properties | White to yellowish powder | | Uses | 1,4-Cyclohexanedione mono(2,2-dimethyltrimethylene ketal)is a reagent used in the preparation of carbazole derivatives. | | Synthesis Reference(s) | Synthetic Communications, 14, p. 39, 1984 DOI: 10.1080/00397918408060862 | | Synthesis | The general procedure for the synthesis of 3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-one using the compound (CAS: 69825-15-6) as starting material was as follows: first, 6.1 mg (0.02 mmol) of sodium 2-iodobenzenesulfonate, 0.49 g (0.8 mmol) of Oxone (registered trademark) powder, 0.5 g (3.5 mmol) anhydrous sodium sulfate and 200 mg (1 mmol) 3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-ol were added to 5 mL of ethyl acetate. Subsequently, the reaction mixture was heated and stirred at 70°C for 8 hours under nitrogen protection. Upon completion of the reaction, post-processing was carried out according to the method of Example 1, resulting in the target product 3,3-dimethyl-1,5-dioxaspiro[5.5]undecan-9-one. The yield of the compound was determined to be 91%, as shown in Table 2. | | References | [1] Patent: EP2085373, 2009, A1. Location in patent: Page/Page column 12; 14-15
[2] Journal of Medicinal Chemistry, 1981, vol. 24, # 3, p. 341 - 346 |
| | 1,4-Cyclohexanedione mono(2,2-dimethyltrimethylene ketal) Preparation Products And Raw materials |
|