| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Chloro-6-fluoropyridine Basic information | | Synthesis |
| | 2-Chloro-6-fluoropyridine Chemical Properties |
| Melting point | 31.0 to 35.0 °C | | Boiling point | 169.2±20.0 °C(Predicted) | | density | 1.331±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol | | form | powder to lump | | pka | -2.45±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C5H3ClFN/c6-4-2-1-3-5(7)8-4/h1-3H | | InChIKey | LXOHKRGLGLETIJ-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(F)=CC=C1 | | CAS DataBase Reference | 20885-12-5(CAS DataBase Reference) |
| | 2-Chloro-6-fluoropyridine Usage And Synthesis |
| Synthesis | However, a recent study demonstrated that a range of substituted pyridines
reacted with fluorine diluted with nitrogen giving 2-fluoropyridine derivatives in
acceptable yields. Thus, 2-chloropyridine gave mostly 2-chloro-6-fluoropyridine.
 | | Chemical Properties | Light yellow needles |
| | 2-Chloro-6-fluoropyridine Preparation Products And Raw materials |
|