|
|
| | 3-(2-FURYL)PROPANOIC ACID Basic information |
| | 3-(2-FURYL)PROPANOIC ACID Chemical Properties |
| Melting point | 56-59 °C | | Boiling point | 229 | | density | 1.2127 (rough estimate) | | refractive index | 1.4638 (estimate) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | form | Crystalline Powder | | pka | 4.51±0.10(Predicted) | | color | Almost white to brown | | InChI | InChI=1S/C7H8O3/c8-7(9)4-3-6-2-1-5-10-6/h1-2,5H,3-4H2,(H,8,9) | | InChIKey | XLTJXJJMUFDQEZ-UHFFFAOYSA-N | | SMILES | O1C=CC=C1CCC(O)=O | | CAS DataBase Reference | 935-13-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-41-37/38 | | Safety Statements | 37/39-26-39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29321900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ACROS
| English |
| | 3-(2-FURYL)PROPANOIC ACID Usage And Synthesis |
| Description | 3-(2-Furyl)propionic acid is a metabolite of furfural that can be found in the urine at physiological levels.
| | Chemical Properties | almost white to brown crystalline powder | | Uses | 3-(2-Furyl)propionic acid can be used as an indicator for monitoring membrane integrity, as it will react with hippuric acid to form 3-(3-hydroxypropyl)furan-2-carboxylic acid, which can then be quantified using high performance liquid chromatography.
| | Synthesis | 3-(2-Furyl)propionic acid is formed by the reaction of furfural with acetyl CoA. |
| | 3-(2-FURYL)PROPANOIC ACID Preparation Products And Raw materials |
|