| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | N2-Methylguanosine Basic information |
| Product Name: | N2-Methylguanosine | | Synonyms: | 2-Methylguanosine;9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-methylamino-3H-purin-6-one;N-Methylguanosine;Guanosine, N-methyl-;m2G;9-((2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-2-(methylamino)-1H-purin-6(9H)-one;N2-Methylguanosine,RNA-modified nucleoside m2G;N2-Methylguanosine,inhibit,Nucleoside Antimetabolite/Analog,N-2-Methylguanosine,Inhibitor,N2Methylguanosine,Endogenous Metabolite,N2 Methylguanosine | | CAS: | 2140-77-4 | | MF: | C11H15N5O5 | | MW: | 297.27 | | EINECS: | | | Product Categories: | Biochemicals and Reagents;Nucleoside Analogs;Nucleosides, Nucleotides, Oligonucleotides | | Mol File: | 2140-77-4.mol |  |
| | N2-Methylguanosine Chemical Properties |
| Melting point | 233 °C (decomp)(Solv: water (7732-18-5)) | | density | 2.00±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMSO : 7.69 mg/mL (25.87 mM; Need ultrasonic)| | | pka | 9.87±0.20(Predicted) | | form | Solid | | color | White to off-white | | PH | 2.3;9.7 | | Water Solubility | Water : 1 mg/mL (3.36 mM; ultrasonic and warming and heat to 80°C) | | λmax | 259 (pH 1)；253 (pH 7)；258 (pH 13) | | InChI | InChI=1S/C11H15N5O5/c1-12-11-14-8-5(9(20)15-11)13-3-16(8)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14,15,20)/t4-,6-,7-,10-/m1/s1 | | InChIKey | SLEHROROQDYRAW-KQYNXXCUSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3=C(C(NC(=N3)NC)=O)N=C2)[C@H](O)[C@@H]1O |
| | N2-Methylguanosine Usage And Synthesis |
| Definition | ChEBI: Guanosine with the hydrogen on the amine at position N-2 substituted with a methyl group. |
| | N2-Methylguanosine Preparation Products And Raw materials |
|