|
|
| | 3-Amino-4-chloropyridine Basic information |
| | 3-Amino-4-chloropyridine Chemical Properties |
| Melting point | 58-63 °C | | Boiling point | 247.6±20.0 °C(Predicted) | | density | 1.326±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | soluble in Methanol | | pka | 3.77±0.10(Predicted) | | form | Powder or Crystals | | color | White to yellow | | BRN | 110187 | | InChI | InChI=1S/C5H5ClN2/c6-4-1-2-8-3-5(4)7/h1-3H,7H2 | | InChIKey | GTLFLMZOABSJSV-UHFFFAOYSA-N | | SMILES | C1=NC=CC(Cl)=C1N | | CAS DataBase Reference | 20511-15-3(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 20/21/22-36/37/38-41-37/38-25 | | Safety Statements | 26-36/37/39-45-39 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 3-Amino-4-chloropyridine Usage And Synthesis |
| Chemical Properties | Off-white Cryst | | Uses | 3-Amino-4-chloropyridine is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| | 3-Amino-4-chloropyridine Preparation Products And Raw materials |
|