7-Methyl-DL-tryptophan manufacturers
|
| | 7-Methyl-DL-tryptophan Basic information |
| | 7-Methyl-DL-tryptophan Chemical Properties |
| Melting point | 296 °C (decomp) | | Boiling point | 448.8±45.0 °C(Predicted) | | density | 1.313±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 2.26±0.10(Predicted) | | form | crystalline | | color | off-white | | InChI | InChI=1S/C12H14N2O2/c1-7-3-2-4-9-8(6-14-11(7)9)5-10(13)12(15)16/h2-4,6,10,14H,5,13H2,1H3,(H,15,16)/t10-/m0/s1 | | InChIKey | KBOZNJNHBBROHM-JTQLQIEISA-N | | SMILES | C(O)(=O)[C@H](CC1C2=C(C(C)=CC=C2)NC=1)N |
| WGK Germany | 3 | | HS Code | 2933998090 |
| | 7-Methyl-DL-tryptophan Usage And Synthesis |
| Uses | 7-Methyl-DL-tryptophan (7-Methyltryptophan) is an amino acid derivative, which is a key precursor for biosynthesis of many non-ribosomal peptide antibiotics. 7-Methyl-DL-tryptophan plays an important role in synthesis of high-efficiency antibacterial agents and analogues thereof[1]. | | References | [1] Jun XY, et, al. Synthesis method of 7-methyltryptophan. CN112062705A. |
| | 7-Methyl-DL-tryptophan Preparation Products And Raw materials |
|