| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Chloro-4-iodo-nicotinic acid Basic information |
| Product Name: | 2-Chloro-4-iodo-nicotinic acid | | Synonyms: | 3-PYRIDINECARBOXYLIC ACID, 2-CHLORO-4-IODO-;2-Chloro-4-iododnicotinic acid;2-chloro-4-iodopyridine-3-carboxylic acid;2-chloro-4-iodo-3-pyridinecarboxylate;2-chloro-4-iodoniacin;2-Chloro-4-Iodinenicotinic Acid;2-chloro-4-iodopyridine-3-carboxylic acid - [C86940];2-Chloro-4-iodo-nicotinic acid | | CAS: | 544671-78-5 | | MF: | C6H3ClINO2 | | MW: | 283.45 | | EINECS: | | | Product Categories: | | | Mol File: | 544671-78-5.mol |  |
| | 2-Chloro-4-iodo-nicotinic acid Chemical Properties |
| Melting point | 175-178°C (dec.) | | Boiling point | 369.3±42.0 °C(Predicted) | | density | 2.193±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 0.73±0.25(Predicted) | | Appearance | Off-white to light yellow Solid | | Sensitive | Light Sensitive | | InChI | InChI=1S/C6H3ClINO2/c7-5-4(6(10)11)3(8)1-2-9-5/h1-2H,(H,10,11) | | InChIKey | XOMBFOCJXYZRSI-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC(I)=C1C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 |
| Provider | Language |
|
ALFA
| English |
| | 2-Chloro-4-iodo-nicotinic acid Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 2-Chloro-4-iodonicotinic acid is used as a pharmaceutical intermediates. |
| | 2-Chloro-4-iodo-nicotinic acid Preparation Products And Raw materials |
|