|
|
| | 5-METHYL-2-NITROBENZYL ALCOHOL Basic information |
| | 5-METHYL-2-NITROBENZYL ALCOHOL Chemical Properties |
| Melting point | 66-67 °C(lit.) | | Boiling point | 314.9±27.0 °C(Predicted) | | density | 1.272±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 14.04±0.10(Predicted) | | Appearance | White to light brown Solid | | InChI | 1S/C8H9NO3/c1-6-2-3-8(9(11)12)7(4-6)5-10/h2-4,10H,5H2,1H3 | | InChIKey | IKEYTRGLCHZQHO-UHFFFAOYSA-N | | SMILES | Cc1ccc(c(CO)c1)[N+]([O-])=O | | CAS DataBase Reference | 66424-92-8 |
| WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2906290090 | | Storage Class | 11 - Combustible Solids |
| | 5-METHYL-2-NITROBENZYL ALCOHOL Usage And Synthesis |
| Uses | 5-Methyl-2-nitrobenzyl alcohol undergoes oxidation in the presence of ammonium chlorochromate adsorbed on montmorillonite K-10 to yield 5-methyl-2-nitrobenzaldehyde. It also undergoes oxidation with chromium trioxide-HZSM-5 zeolite under microwave irradiation on solventless system. | | General Description | 5-Methyl-2-nitrobenzyl alcohol undergoes oxidation in the presence of ammonium chlorochromate adsorbed on montmorillonite K-10 to yield 5-methyl-2-nitrobenzaldehyde. It also undergoes oxidation with chromium trioxide-HZSM-5 zeolite under microwave irradiation on solventless system. |
| | 5-METHYL-2-NITROBENZYL ALCOHOL Preparation Products And Raw materials |
|