| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Resorufin benzyl ether Basic information |
| Product Name: | Resorufin benzyl ether | | Synonyms: | 7-BENZYLOXY-3H-PHENOXAZIN-3-ONE;7-BENZYLOXYRESORUFIN;BENZYLOXYRESORUFIN;3H-Phenoxazin-3-one, 7-(phenylmethoxy)-;BENZYLOXYRESORUFIN [RESORUFIN BENZYL ETHER];7-Benzyloxy-3H-phenoxazin-3-one, 7-Benzyloxyresorufin, O7-Benzylresorufin;7-Benzyloxyphenoxazone;Benzyloxyresorfin | | CAS: | 87687-02-3 | | MF: | C19H13NO3 | | MW: | 303.31 | | EINECS: | | | Product Categories: | | | Mol File: | 87687-02-3.mol |  |
| | Resorufin benzyl ether Chemical Properties |
| Melting point | 148 - 151°C | | Boiling point | 479.9±45.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Very Slightly), Methanol (Very Slightly) | | pka | 1.36±0.20(Predicted) | | form | Solid | | color | Red to Very Dark Brown | | Appearance | Solid Powder | | InChI | 1S/C19H13NO3/c21-14-6-8-16-18(10-14)23-19-11-15(7-9-17(19)20-16)22-12-13-4-2-1-3-5-13/h1-11H,12H2 | | InChIKey | XNZRYTITWLGTJS-UHFFFAOYSA-N | | SMILES | O=C1C=CC2=Nc3ccc(OCc4ccccc4)cc3OC2=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Resorufin benzyl ether Usage And Synthesis |
| Description | Resorufin benzyl ether is a red fluorometric probe that acts as a substrate for cytochrome P450 CYP3A4. It is used to screen the inhibition/activation potential of test compounds, to predict potential drug-drug interactions, or to monitor other CYP450 activities. | | Uses | Fluorimetric substrate for cytochrome P450-linked enzymes. | | Uses | Resorufin Benzyl Ether is a fluorogenic substrate for CYP (cytochrome P450-linked enzymes), commonly used for monitoring P450 activities in cell extracts and solutions. | | Excitation / Emission Maximum | 571 nm/585 nm |
| | Resorufin benzyl ether Preparation Products And Raw materials |
|