| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-Acetylneuraminic acid methyl ester Basic information |
| Product Name: | N-Acetylneuraminic acid methyl ester | | Synonyms: | N-Acetylneuraminic acid methyl ester, Min. 97%;METHYL 5-ACETAMIDO-3,5-DIDEOXY-BETA-D-GLYCERO-D-GALACTO-2-NONULOPYRANOSYLONATE;5-(AcetylaMino)-3,5-dideoxy-D-glycero-β-D-galacto-2-nonulopyranosonic Acid
Methyl Ester;(2S,4S,5S,6R)-Methyl 5-acetaMido-2,4-dihydroxy-6-((1R,2R)-1,2,3-trihydroxypropyl)tetrahydro-2H-pyran-2-carboxylate;N-Acetylneuraminic Acid Methyl Ester;(2S,4S,5R,6R);-1,2,3-trihydroxypropyl);-Methyl 5-acetamido-2,4-dihydroxy-6-((1R,2R) | | CAS: | 22900-11-4 | | MF: | C12H21NO9 | | MW: | 323.3 | | EINECS: | | | Product Categories: | Carbohydrates & Derivatives;Biochemistry;Sialic Acids;Sugars | | Mol File: | 22900-11-4.mol |  |
| | N-Acetylneuraminic acid methyl ester Chemical Properties |
| Melting point | 193.5-194.5°C | | Boiling point | 693.8±55.0 °C(Predicted) | | density | 1.51±0.1 g/cm3(Predicted) | | refractive index | -27.5 ° (C=1, H2O) | | storage temp. | Freezer | | Water Solubility | Slightly soluble in water | | solubility | soluble in Methanol | | pka | 10.40±0.70(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1/C12H21NO9/c1-5(15)13-8-6(16)3-12(20,11(19)21-2)22-10(8)9(18)7(17)4-14/h6-10,14,16-18,20H,3-4H2,1-2H3,(H,13,15)/t6-,7+,8+,9+,10+,12-/s3 | | InChIKey | BKZQMWNJESHHSA-AGNBLMTLSA-N | | SMILES | [C@@H]([C@]1([H])O[C@](O)(C(=O)OC)C[C@H](O)[C@H]1NC(=O)C)(O)[C@H](O)CO |&1:0,1,4,11,13,19,r| | | CAS DataBase Reference | 22900-11-4 |
| | N-Acetylneuraminic acid methyl ester Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | Derivative of Neuraminic Acid |
| | N-Acetylneuraminic acid methyl ester Preparation Products And Raw materials |
|