- N-Acetyl-L-glutamic acid
-
- $0.00 / 25Kg/Drum
-
2026-04-14
- CAS:1188-37-0
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 1000kgs
|
| | N-Acetyl-L-glutamic acid Basic information |
| | N-Acetyl-L-glutamic acid Chemical Properties |
| Melting point | 194-196 °C(lit.) | | alpha | -16 º (c=1, water) | | Boiling point | 324.41°C (rough estimate) | | density | 1.4119 (rough estimate) | | FEMA | 4752 | N-ACETYL GLUTAMATE | | refractive index | -15 ° (C=1, H2O) | | storage temp. | 2-8°C | | solubility | 36g/l (Lit.) | | pka | 3.45±0.10(Predicted) | | form | Solid | | color | White | | Optical Rotation | [α]22/D 15.6°, c = 1 in H2O | | Water Solubility | 2.7 g/100 mL (20 ºC) | | JECFA Number | 2269 | | BRN | 1727473 | | Major Application | peptide synthesis | | Cosmetics Ingredients Functions | SKIN CONDITIONING | | Cosmetic Ingredient Review (CIR) | N-Acetyl-L-glutamic acid (1188-37-0) | | InChI | 1S/C7H11NO5/c1-4(9)8-5(7(12)13)2-3-6(10)11/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13)/t5-/m0/s1 | | InChIKey | RFMMMVDNIPUKGG-YFKPBYRVSA-N | | SMILES | CC(=O)N[C@@H](CCC(O)=O)C(O)=O | | LogP | -2.131 (est) | | CAS DataBase Reference | 1188-37-0(CAS DataBase Reference) | | NIST Chemistry Reference | N-acetyl-l-glutamic acid(1188-37-0) | | EPA Substance Registry System | L-Glutamic acid, N-acetyl- (1188-37-0) |
| Safety Statements | 24/25 | | WGK Germany | 2 | | RTECS | LZ9725000 | | TSCA | TSCA listed | | HS Code | 29241900 | | Storage Class | 11 - Combustible Solids |
| | N-Acetyl-L-glutamic acid Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | N-Acetyl-L-glutamic Acid is the N-Acetyl analogue of the non-essential amino acid, L-glutamic acid (G596960). N-Acetyl-L-glutamic Acid activates carbamoyl phosphate synthetase in the urea cycle. | | Uses | Substrate for acetylglutamate kinase. Inhibitor of N-acetyl-L-glutamate synthetase | | Uses | N-Acetyl-L-glutamic acid is used as pharmaceutical intermediates. | | Definition | ChEBI: N-acetyl-L-glutamic acid is an N-acyl-L-amino acid that is L-glutamic acid in which one of the amine hydrogens is substituted by an acetyl group. It has a role as a Saccharomyces cerevisiae metabolite and a human metabolite. It is a N-acetyl-L-amino acid and a N-acyl-L-glutamic acid. It is functionally related to a L-glutamic acid. It is a conjugate acid of a N-acetyl-L-glutamate(1-). | | reaction suitability | reaction type: solution phase peptide synthesis | | Purification Methods | A likely impurity is glutamic acid. Crystallise it from boiling water. It inhibits N-acetyl-L-glutamate synthase. [Greenstein & Winitz The Chemistry of the Amino Acids J. Wiley, Vol 3 p 1948 1961, Shigesada & Tatibana Eur J Biochem 84 285 1978, Coude Biochem Biophys Res Commun 102 1016 1981, Beilstein 4 IV 3047.] |
| | N-Acetyl-L-glutamic acid Preparation Products And Raw materials |
|