|
|
| | N-Acetyl-β-neuraminic acid methyl ester monohydrate Basic information |
| Product Name: | N-Acetyl-β-neuraminic acid methyl ester monohydrate | | Synonyms: | N-Acetyneuraminic;N-ACETYLNEURAMIC ACID METHYL ESTER;N-ACETYL-D-NEURAMINIC ACID METHYL ESTER;N-Acetyl-D-neuraminic acid methyl ester or Sialic acid methyl ester;N-Acetyl-D-neuraminic acid methyl ester 97%;N-Acetyl-D-neuraminicacidmethylester97%;5-acetamido-2,4-dihydroxy-6-(1,2,3-trihydroxypropyl)-2-oxanecarboxylic acid methyl ester;Methyl (2S,4S,5R,6R)-5-acetamido-2,4-dihydroxy-6-((1R,2R)-1,2,3-trihydroxypropyl)tetrahydro-2H-pyran-2-carboxylate | | CAS: | 50998-13-5 | | MF: | C12H21NO9 | | MW: | 323.3 | | EINECS: | 604-604-1 | | Product Categories: | Aromatic Esters;13C & 2H Sugars;Carbohydrates & Derivatives;Carbohydrates A to;Carbohydrates A-CBiochemicals and Reagents;Carbohydrates;Monosaccharide | | Mol File: | 50998-13-5.mol |  |
| | N-Acetyl-β-neuraminic acid methyl ester monohydrate Chemical Properties |
| Melting point | 193.5-194.5 | | storage temp. | −20°C | | solubility | Methanol | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C12H21NO9.H2O/c1-5(15)13-8-6(16)3-12(20,11(19)21-2)22-10(8)9(18)7(17)4-14;/h6-10,14,16-18,20H,3-4H2,1-2H3,(H,13,15);1H2/t6-,7+,8+,9+,10+,12-;/m0./s1 | | InChIKey | UIUNVNKHJXXRLV-JYMIJESRSA-N | | SMILES | C(OC)(=O)[C@@]1(C[C@H](O)[C@@H](NC(=O)C)[C@H]([C@@H]([C@@H](CO)O)O)O1)O.[H]O[H] | | CAS DataBase Reference | 50998-13-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29329990 |
| | N-Acetyl-β-neuraminic acid methyl ester monohydrate Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | Derivative of Neuraminic Acid |
| | N-Acetyl-β-neuraminic acid methyl ester monohydrate Preparation Products And Raw materials |
|