c-di-AMP manufacturers
- c-di-AMP
-
-
2026-05-11
- CAS:54447-84-6
- Purity:
- Supply Ability: 10g
|
| | c-di-AMP Basic information |
| Product Name: | c-di-AMP | | Synonyms: | c-di-AMP;di-AMP;di-cAMP;Cyclic di-3',5'-adenylate;Cyclic diadenylate;Cyclic-di-AMP;c-di-AMP (Cyclic diadenylate;3'-Adenylic acid, adenylyl-(3'→5')-, cyclic nucleotide | | CAS: | 54447-84-6 | | MF: | C20H24N10O12P2 | | MW: | 658.42 | | EINECS: | | | Product Categories: | Nucleotide | | Mol File: | 54447-84-6.mol |  |
| | c-di-AMP Chemical Properties |
| Boiling point | 1096.7±75.0 °C(Predicted) | | density | 2.52±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO | | form | powder | | pka | 0.96±0.70(Predicted) | | color | white to beige | | InChIKey | PDXMFTWFFKBFIN-XPWFQUROSA-N | | SMILES | NC1=NC=NC2=C1N=CN2[C@H](O3)[C@H](O)[C@H](OP(OC[C@@H]4[C@@H](O5)[C@@H](O)[C@H](N6C=NC7=C6N=CN=C7N)O4)(O)=O)[C@H]3COP5(O)=O.C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | c-di-AMP Usage And Synthesis |
| Uses | Cyclic di-AMP (c-di-AMP) is a second messenger produced by bacteria. It impacts bacterial cell growth, cell wall homeostasis, pathogenicity, and other cellular functions. | | Definition | ChEBI: Cyclic di-AMP is a cyclic purine dinucleotide that is the 3',5'-cyclic dimer of AMP. It has a role as a Mycoplasma genitalium metabolite. It is a cyclic purine dinucleotide and an adenyl ribonucleotide. It is a conjugate acid of a cyclic di-AMP(2-). | | Biochem/physiol Actions | c-di-AMP is a bacterial secondary messenger. c-di-AMP acts as a potent mucosal adjuvant stimulating both humoral and cellular responses. |
| | c-di-AMP Preparation Products And Raw materials |
|