- Carbic anhydride
-
- $8.90
-
2026-03-20
- CAS:129-64-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- Carbic anhydride
-
- $1.00
-
2019-07-06
- CAS:129-64-6
- Min. Order: 1G
- Purity: 99%
- Supply Ability: 100kg
|
| | Carbic anhydride Basic information |
| Product Name: | Carbic anhydride | | Synonyms: | 2-Methyl-5-(prop-1-en-2-yl)cyclohex-2-enecarboxylic anhydride;(3aR,4S,7R,7aS)-rel-3a,4,7,7a-Tetrahydro-4,7-Methanoisobenzofuran-1,3-dione;3-4,7,7-Tetrahydro-4,7-methanoiso-benzo-furan-1,3-dione;3aα,4α,7α,7aα-3a,4,7,7a-tetrahydro-4,7-methano-isobenzofuran-1,3-dione;4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro-;4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydro-, (3aalpha,4alpha,7alpha,7aalpha)-;4,7-Methanoisobenzofuran-1,3-dione,3a,4,7,7a-tetrahydro-,(3a.alpha.,4.alpha.,7.alpha.,7a.alpha.)-;4,7-Methanoisobenzofuran-1,3-dione,3a,4,7,7a-tetrahydro-,(3aR,4S,7R,7aS)-rel- | | CAS: | 129-64-6 | | MF: | C9H8O3 | | MW: | 164.16 | | EINECS: | 204-957-7 | | Product Categories: | Industrial/Fine Chemicals;Piperidines ,Piperazines ,Homopiperidines | | Mol File: | 129-64-6.mol |  |
| | Carbic anhydride Chemical Properties |
| Melting point | 165-167 °C(lit.) | | Boiling point | 251.61°C (rough estimate) | | density | 1.08 | | refractive index | 1.4365 | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Crystalline Powder | | color | White | | Water Solubility | DECOMPOSES | | Sensitive | Moisture Sensitive | | Merck | 14,1796 | | BRN | 83657 | | InChI | InChI=1/C9H8O3/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8/h1-2,4-7H,3H2/t4-,5+,6-,7+ | | InChIKey | KNDQHSIWLOJIGP-UMRXKNAANA-N | | SMILES | C1(=O)[C@]2([H])[C@@]([H])([C@@]3([H])C[C@]2([H])C=C3)C(=O)O1 |&1:2,4,6,9,r| | | CAS DataBase Reference | 129-64-6(CAS DataBase Reference) | | NIST Chemistry Reference | Endo-5-norbornene-2,3-dicarboxylic anhydride(129-64-6) |
| Hazard Codes | Xn | | Risk Statements | 41-42/43 | | Safety Statements | 22-24-26-37/39 | | WGK Germany | 3 | | RTECS | DT5600000 | | F | 21 | | HS Code | 29172090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
| | Carbic anhydride Usage And Synthesis |
| Chemical Properties | WHITE CRYSTALLINE POWDER | | Uses | Carbic Anhydride is an intermediate used to prepare Endo-2,3-Norbornanedicarboximide (N661225) which is used to prepare piperidinylbenzisoxazole antipsychotic drugs. | | Purification Methods | -methanoisobenzofuran-1,3-dione) [129-64-6] M 164.2, m 164.1o, 164 -1 6 5o, 165-167o, d 4 1.417. It forms crystals from pet ether, hexane or cyclohexane. It is hydrolysed by H2O to form the acid [Diels & Alder Justus Liebigs Ann Chem 460 98 1928, Maitte B |
| | Carbic anhydride Preparation Products And Raw materials |
| Raw materials | Maleic anhydride-->1,3-Cyclopentadiene-->CIS-5-NORBORNENE-EXO-2,3-DICARBOXYLIC ANHYDRIDE | | Preparation Products | CIS-5-NORBORNENE-EXO-2,3-DICARBOXYLIC ANHYDRIDE-->CIS-5-NORBORNENE-ENDO-2,3-DICARBOXYLIC ACID-->N-(2-Ethylhexyl)-5-norbornene-2,3-dicarboximide-->2,2-DIFLUOROETHYLAMINE-->MONO-METHYL CIS-5-NORBORNENE-ENDO-2,3-DICARBOXYLATE-->Nsc140602-->4,7-Methano-2H-isoindole-2-propanoic acid, 1,3,3a,4,7,7a-hexahydro-1,3-dioxo-, (3aR,4S,7R,7aS)-rel- |
|