- 2,2-Difluoroethylamine
-
- $5.00 / 25kg
-
2026-04-17
- CAS:430-67-1
- Min. Order: 1kg
- Purity: ≥99%
- Supply Ability: 200mt/year
- 2,2-DIFLUOROETHYLAMINE
-
- $0.00 / 25kg
-
2025-12-01
- CAS:430-67-1
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
|
| | 2,2-DIFLUOROETHYLAMINE Basic information |
| Product Name: | 2,2-DIFLUOROETHYLAMINE | | Synonyms: | CF2HCH2NH2;AKOS B028561;2,2-DIFLUOROETHYLAMINE;TIMTEC-BB SBB009831;2,3-Difluoroethylamine;1-Amino-2,2-difluoroethane;2,2-difluoroethanaMine;2-Amino-1,1-difluoroethane | | CAS: | 430-67-1 | | MF: | C2H5F2N | | MW: | 81.06 | | EINECS: | 671-709-6 | | Product Categories: | | | Mol File: | 430-67-1.mol |  |
| | 2,2-DIFLUOROETHYLAMINE Chemical Properties |
| Boiling point | 67.5-68.5 | | density | 1,15 g/cm3 | | vapor pressure | 14-56kPa at 20-50℃ | | refractive index | 1.3410-1.3450 | | form | clear liquid | | pka | 7.09±0.30(Predicted) | | color | Colorless to Yellow | | InChI | InChI=1S/C2H5F2N/c3-2(4)1-5/h2H,1,5H2 | | InChIKey | OVRWUZYZECPJOB-UHFFFAOYSA-N | | SMILES | C(N)C(F)F | | CAS DataBase Reference | 430-67-1(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34-36/37 | | Safety Statements | 26-36/37/39-24/25 | | RIDADR | 2735 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | PackingGroup | II | | HS Code | 29211990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Irrit. 2 Met. Corr. 1 STOT SE 3 |
| | 2,2-DIFLUOROETHYLAMINE Usage And Synthesis |
| Chemical Properties | Liquid |
| | 2,2-DIFLUOROETHYLAMINE Preparation Products And Raw materials |
|