| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Bromo-2-fluoro-3-iodobenzene Basic information |
| Product Name: | 1-Bromo-2-fluoro-3-iodobenzene | | Synonyms: | 3-Bromo-2-fluoroiodobenzene;1-Bromo-2-fluoro-3-iodobenzene;Benzene, 1-bromo-2-fluoro-3-iodo-;1-Bromo-2-fluoro-3-iodobenzene ISO 9001：2015 REACH;2-Fluoro-17-(methylthio)pyridine | | CAS: | 958458-89-4 | | MF: | C6H3BrFI | | MW: | 300.89 | | EINECS: | | | Product Categories: | | | Mol File: | 958458-89-4.mol |  |
| | 1-Bromo-2-fluoro-3-iodobenzene Chemical Properties |
| Boiling point | 248.8±25.0 °C(Predicted) | | density | 2.281±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Appearance | Light brown to brown Solid | | InChI | InChI=1S/C6H3BrFI/c7-4-2-1-3-5(9)6(4)8/h1-3H | | InChIKey | AEBOPKUWEXVTNN-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC(I)=C1F |
| | 1-Bromo-2-fluoro-3-iodobenzene Usage And Synthesis |
| Uses | 1-Bromo-2-fluoro-3-iodobenzene is a simple aromatic hydrocarbon derivative containing several halogenated substitutable groups, such as bromine, fluorine and iodine, on its benzene ring structure. It can be used as a raw material for the preparation of other heterocyclic compounds and as a synthetic intermediate. |
| | 1-Bromo-2-fluoro-3-iodobenzene Preparation Products And Raw materials |
|