| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
FAM azide, 6-isomer manufacturers
- FAM azide,6-isomer
-
-
2025-06-07
- CAS:1386385-76-7
- Min. Order: 5mg
- Purity: >99.00%
- Supply Ability: 5mg
|
| | FAM azide, 6-isomer Basic information |
| Product Name: | FAM azide, 6-isomer | | Synonyms: | FAM azide, 6-isomer;FAM azide,6-isomer (DMSO solution);Fluorescein Azide;6-fam-N3;FITC-Azide;FITC-N3;Poly(ethylene glycol) diacrylate (MW 250),MEHQ as inhibitor | | CAS: | 1386385-76-7 | | MF: | C24H18N4O6 | | MW: | 458.42 | | EINECS: | | | Product Categories: | | | Mol File: | 1386385-76-7.mol |  |
| | FAM azide, 6-isomer Chemical Properties |
| Melting point | 225-230 °C | | storage temp. | -20°C | | solubility | Soluble in DMSO, DMF, DCM | | form | Solid | | pka | 9.325±0.20(predicted) | | color | Light yellow to yellow | | Appearance | yellowish crystals | | InChIKey | SJAGNCADRVABJA-UHFFFAOYSA-N | | SMILES | [N+](=[N-])=NCCCNC(=O)c1cc(c(cc1)C(=O)O)C2=C3C(=CC(=O)C=C3)Oc4c2ccc(c4)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | FAM azide, 6-isomer Usage And Synthesis |
| Description | FAM (fluorescein) azide, pure 6-isomer, is a Click Chemistry labeling reagent.
This reagent can replace Alexa Fluor 488 and DyLight 488. | | Uses | This 488nm absorbing dye is probably the most popular dye in cell biology and represents an alternative to Alexa Fluor 488 and the DyLight 488. Fluorescent dye azides can be used for the fluorescent labeling of terminal alkyne-modified molecules by the Cu(I)-catalyzed azide-alkyne (CuAAC) reaction (click reaction). | | reaction suitability | reaction type: click chemistry | | Abs/Em Maxima | 492/517 nm | | Fluoresene quantum yield | 0.93 | | Extinction Coefficient | 74000 | | CF260 | 0.22 | | CF280 | 0.17 |
| | FAM azide, 6-isomer Preparation Products And Raw materials |
|