| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Azidoacetic acid NHS ester Basic information |
| Product Name: | Azidoacetic acid NHS ester | | Synonyms: | Azidoacetic acid NHS ester;(2,5-dioxopyrrolidin-1-yl) 2-azidoacetate;2-Azidoacetic acid 2,5-dioxo-1-pyrrolidinyl ester;NHS-Azide;NHS-Ac-N3;Aeide-C1-NHS ester;Azidoacetic acid NHS ester,2-Azidoacetic acid 2,5-dioxo-1-pyrrolidinyl ester;2,5-Pyrrolidinedione, 1-[(azidoacetyl)oxy]- | | CAS: | 824426-32-6 | | MF: | C6H6N4O4 | | MW: | 198.14 | | EINECS: | | | Product Categories: | | | Mol File: | 824426-32-6.mol |  |
| | Azidoacetic acid NHS ester Chemical Properties |
| Melting point | 132-133o C | | storage temp. | -20°C | | solubility | Chloroform (Slightly) | | form | powder or crystals | | color | White to Off-White | | InChI | InChI=1S/C6H6N4O4/c7-9-8-3-6(13)14-10-4(11)1-2-5(10)12/h1-3H2 | | InChIKey | FENNDBOWHRZLTQ-UHFFFAOYSA-N | | SMILES | O(N1C(CCC1=O)=O)C(=O)CN=[N+]=[N-] |
| WGK Germany | WGK 3 | | Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials | | Hazard Classifications | Self-react. C |
| | Azidoacetic acid NHS ester Usage And Synthesis |
| Description | Azidoacetic acid NHS ester is a compound containing an azide group and an NHS ester. The azide group can react with alkyne, BCN, DBCO via Click Chemistry to yield a stable triazole linkage. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. | | Uses | Azidoacetic acid NHS ester is a simple azido-containing reagent with an N-hydroxysuccinimide (NHS) ester that can be reacted with primary amines at pH 7-9 forming a stable amide bond. The azide allows for chemoselective ligation with an alkyne or cyclooctyne. It is generally used to functionalize amines and amino acids with azidoacetyl groups. It is generally used in click chemistry applications. | | reaction suitability | reagent type: cross-linking reagent | | IC 50 | Alkyl/ether |
| | Azidoacetic acid NHS ester Preparation Products And Raw materials |
|